Products 104222-41-5
CAS 104222-41-5 is the registry number for 3-Bromo-2,4,5-trifluorobenzonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3-bromo-2,4,5-trifluorobenzonitrile (CAS 104222-41-5) is a chemical compound with the molecular formula C7HBrF3N and a molecular weight of 235.99 g/mol. IUPAC name: 3-bromo-2,4,5-trifluorobenzonitrile. InChIKey: OQPHQCPPPSTEEL-UHFFFAOYSA-N.
| Molecular formula | C7HBrF3N |
|---|---|
| Molecular weight | 235.99 g/mol |
| IUPAC name | 3-bromo-2,4,5-trifluorobenzonitrile |
| InChIKey | OQPHQCPPPSTEEL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)F)C#N |
Computed by PubChem (NCBI)