CAS 104236-33-1 is the registry number for Tartrazine Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
Disodium;5-oxo-1-phenyl-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate (CAS 104236-33-1) is a chemical compound with the molecular formula C16H10N4Na2O6S and a molecular weight of 432.3 g/mol. IUPAC name: disodium;5-oxo-1-phenyl-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate. InChIKey: DOQBXWGTEAXBBJ-UHFFFAOYSA-L.
| Molecular formula | C16H10N4Na2O6S |
|---|---|
| Molecular weight | 432.3 g/mol |
| IUPAC name | disodium;5-oxo-1-phenyl-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate |
| InChIKey | DOQBXWGTEAXBBJ-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(C(=N2)C(=O)[O-])N=NC3=CC=C(C=C3)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)