Products 1042425-92-2

CAS 1042425-92-2 is the registry number for 1-Benzyl-4-ethoxy-1,4-azaphosphinane 4-oxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

1-benzyl-4-ethoxy-1,4lambda5-azaphosphinane 4-oxide (CAS 1042425-92-2) is a chemical compound with the molecular formula C13H20NO2P and a molecular weight of 253.28 g/mol. IUPAC name: 1-benzyl-4-ethoxy-1,4lambda5-azaphosphinane 4-oxide. InChIKey: LRUWTESIKOAMDK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20NO2P
Molecular weight253.28 g/mol
IUPAC name1-benzyl-4-ethoxy-1,4lambda5-azaphosphinane 4-oxide
InChIKeyLRUWTESIKOAMDK-UHFFFAOYSA-N
SMILESCCOP1(=O)CCN(CC1)CC2=CC=CC=C2

Computed by PubChem (NCBI)