CAS 1042608-94-5 appears in our catalog under these names: N-{3-((propan-2-yl)amino)phenyl}methanesulfonamide, 95%, N-{3-((Propan-2-yl)amino)phenyl}methanesulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
N-[3-(propan-2-ylamino)phenyl]methanesulfonamide (CAS 1042608-94-5) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: N-[3-(propan-2-ylamino)phenyl]methanesulfonamide. InChIKey: BXYXGVKJAKVHAK-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | N-[3-(propan-2-ylamino)phenyl]methanesulfonamide |
| InChIKey | BXYXGVKJAKVHAK-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=CC(=CC=C1)NS(=O)(=O)C |
Computed by PubChem (NCBI)