CAS 1042941-53-6 is the registry number for 4,4''-Bis(diphenylamino)-[1,1':4',1''-terphenyl]-2',5'-dicarbaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,5-bis[4-(N-phenylanilino)phenyl]terephthalaldehyde (CAS 1042941-53-6) is a chemical compound with the molecular formula C44H32N2O2 and a molecular weight of 620.7 g/mol. IUPAC name: 2,5-bis[4-(N-phenylanilino)phenyl]terephthalaldehyde. InChIKey: FOSFMFPIJSMIGU-UHFFFAOYSA-N.
| Molecular formula | C44H32N2O2 |
|---|---|
| Molecular weight | 620.7 g/mol |
| IUPAC name | 2,5-bis[4-(N-phenylanilino)phenyl]terephthalaldehyde |
| InChIKey | FOSFMFPIJSMIGU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC(=C(C=C4C=O)C5=CC=C(C=C5)N(C6=CC=CC=C6)C7=CC=CC=C7)C=O |
Computed by PubChem (NCBI)