Products 104296-63-1

CAS 104296-63-1 appears in our catalog under these names: 2–(1–Naphthyl)ethanesulfonyl Chloride, 2-(1-Naphthyl)ethanesulfonyl chloride, 95%, 2-(Naphthalen-1-yl)ethanesulfonyl chloride, 95+%, 2-(1-Naphthyl)ethanesulfonyl Chloride, 97.0%, 97.0%, 2-(Naphthalen-1-yl)ethanesulfonyl chloride, 95%. Offered by: GLPBio, Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-naphthalen-1-ylethanesulfonyl chloride (CAS 104296-63-1) is a chemical compound with the molecular formula C12H11ClO2S and a molecular weight of 254.73 g/mol. IUPAC name: 2-naphthalen-1-ylethanesulfonyl chloride. InChIKey: IAZQBUVCHCLINF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11ClO2S
Molecular weight254.73 g/mol
IUPAC name2-naphthalen-1-ylethanesulfonyl chloride
InChIKeyIAZQBUVCHCLINF-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC=C2CCS(=O)(=O)Cl

Computed by PubChem (NCBI)