CAS 1042972-65-5 appears in our catalog under these names: 7-Amino-1,4-dihydro-2H-benzo(d)(1,3)oxazin-2-one, 95%, 7-Amino-1H-benzo[d][1,3]oxazin-2(4H)-one, >95%, >95%, 7-AMINO-1H-BENZO[D][1,3]OXAZIN-2(4H)-ONE, >95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg.
7-amino-1,4-dihydro-3,1-benzoxazin-2-one (CAS 1042972-65-5) is a chemical compound with the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. IUPAC name: 7-amino-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: CZLCXZFEQSFCET-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 7-amino-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | CZLCXZFEQSFCET-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)N)NC(=O)O1 |
Computed by PubChem (NCBI)