CAS 1043-50-1 appears in our catalog under these names: Pentafluorophenyl sulfide, 95%, Decafluorodiphenyl sulfide, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)sulfanylbenzene (CAS 1043-50-1) is a chemical compound with the molecular formula C12F10S and a molecular weight of 366.18 g/mol. IUPAC name: 1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)sulfanylbenzene. InChIKey: ZOUZMRQINDFFOK-UHFFFAOYSA-N.
| Molecular formula | C12F10S |
|---|---|
| Molecular weight | 366.18 g/mol |
| IUPAC name | 1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)sulfanylbenzene |
| InChIKey | ZOUZMRQINDFFOK-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)SC2=C(C(=C(C(=C2F)F)F)F)F)F)F)F |
Computed by PubChem (NCBI)