CAS 104315-28-8 is the registry number for Tigolaner Related Compound 1. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole (CAS 104315-28-8) is a chemical compound with the molecular formula C7H3F9N2 and a molecular weight of 286.10 g/mol. IUPAC name: 5-fluoro-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole. InChIKey: WLZXOARVJYAXQK-UHFFFAOYSA-N.
| Molecular formula | C7H3F9N2 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | 5-fluoro-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole |
| InChIKey | WLZXOARVJYAXQK-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(C(F)(F)F)(F)F)C(F)(F)F)F |
Computed by PubChem (NCBI)