CAS 10433-59-7 appears in our catalog under these names: 2,4-DB Sodium Salt, 2,4-DB Sodium. Offered by: TRC, Biosynth. Available pack sizes: 1g, 1000mg.
Sodium 4-(2,4-dichlorophenoxy)butanoate (CAS 10433-59-7) is a chemical compound with the molecular formula C10H9Cl2NaO3 and a molecular weight of 271.07 g/mol. IUPAC name: sodium 4-(2,4-dichlorophenoxy)butanoate. InChIKey: PPKIJAQKBAYNNL-UHFFFAOYSA-M.
| Molecular formula | C10H9Cl2NaO3 |
|---|---|
| Molecular weight | 271.07 g/mol |
| IUPAC name | sodium 4-(2,4-dichlorophenoxy)butanoate |
| InChIKey | PPKIJAQKBAYNNL-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)