CAS 104333-00-8 appears in our catalog under these names: 3-((2-Nitro-4-(trifluoromethyl)-phenyl)amino)propane-1,2-diol, >95% (HPLC), 3-((2-Nitro-4-(Trifluoromethyl)Phenyl)Amino)-1,2-Propanediol. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 50mg, 1000mg.
3-[2-nitro-4-(trifluoromethyl)anilino]propane-1,2-diol (CAS 104333-00-8) is a chemical compound with the molecular formula C10H11F3N2O4 and a molecular weight of 280.20 g/mol. IUPAC name: 3-[2-nitro-4-(trifluoromethyl)anilino]propane-1,2-diol. InChIKey: XDHQHBSDKYPJRG-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2O4 |
|---|---|
| Molecular weight | 280.20 g/mol |
| IUPAC name | 3-[2-nitro-4-(trifluoromethyl)anilino]propane-1,2-diol |
| InChIKey | XDHQHBSDKYPJRG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])NCC(CO)O |
Computed by PubChem (NCBI)