CAS 104333-87-1 is the registry number for MED 27, 90.000000%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate (CAS 104333-87-1) is a chemical compound with the molecular formula C24H25N5O5 and a molecular weight of 463.5 g/mol. IUPAC name: 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate. InChIKey: TYIRBZOAKBEYEJ-UHFFFAOYSA-N.
| Molecular formula | C24H25N5O5 |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate |
| InChIKey | TYIRBZOAKBEYEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=C(N2C)CC(=O)OCCN3C=NC4=C3C(=O)N(C(=O)N4C)C |
Computed by PubChem (NCBI)