CAS 104340-41-2 is the registry number for NC-1300-B. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(6-methoxy-1H-benzimidazol-2-yl)sulfinylmethyl]-N,N-dimethylaniline (CAS 104340-41-2) is a chemical compound with the molecular formula C17H19N3O2S and a molecular weight of 329.4 g/mol. IUPAC name: 2-[(6-methoxy-1H-benzimidazol-2-yl)sulfinylmethyl]-N,N-dimethylaniline. InChIKey: XEACPNJGCWYTPJ-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O2S |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 2-[(6-methoxy-1H-benzimidazol-2-yl)sulfinylmethyl]-N,N-dimethylaniline |
| InChIKey | XEACPNJGCWYTPJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC=C1CS(=O)C2=NC3=C(N2)C=C(C=C3)OC |
Computed by PubChem (NCBI)