Products 104363-98-6
CAS 104363-98-6 is the registry number for Y-20811 (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 4-[hydroxy-(5-imidazol-1-yl-2-methylphenyl)methyl]-3,5-dimethylbenzoate (CAS 104363-98-6) is a chemical compound with the molecular formula C20H19N2NaO3 and a molecular weight of 358.4 g/mol. IUPAC name: sodium 4-[hydroxy-(5-imidazol-1-yl-2-methylphenyl)methyl]-3,5-dimethylbenzoate. InChIKey: HRUWEADDSLYBSH-UHFFFAOYSA-M.
| Molecular formula | C20H19N2NaO3 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | sodium 4-[hydroxy-(5-imidazol-1-yl-2-methylphenyl)methyl]-3,5-dimethylbenzoate |
| InChIKey | HRUWEADDSLYBSH-UHFFFAOYSA-M |
| SMILES | CC1=C(C=C(C=C1)N2C=CN=C2)C(C3=C(C=C(C=C3C)C(=O)[O-])C)O.[Na+] |
Computed by PubChem (NCBI)