Products 1043712-39-5
CAS 1043712-39-5 is the registry number for Heme Oxygenase-1-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-[[2-(3-bromophenyl)quinazolin-4-yl]amino]ethyl]-4-fluorobenzenesulfonamide (CAS 1043712-39-5) is a chemical compound with the molecular formula C22H18BrFN4O2S and a molecular weight of 501.4 g/mol. IUPAC name: N-[2-[[2-(3-bromophenyl)quinazolin-4-yl]amino]ethyl]-4-fluorobenzenesulfonamide. InChIKey: YXFLJALJHOYQOL-UHFFFAOYSA-N.
| Molecular formula | C22H18BrFN4O2S |
|---|---|
| Molecular weight | 501.4 g/mol |
| IUPAC name | N-[2-[[2-(3-bromophenyl)quinazolin-4-yl]amino]ethyl]-4-fluorobenzenesulfonamide |
| InChIKey | YXFLJALJHOYQOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)C3=CC(=CC=C3)Br)NCCNS(=O)(=O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)
Synonyms:
Heme Oxygenase-1-IN-3, orb2663703