CAS 1043867-42-0 appears in our catalog under these names: N-(tert-Butoxycarbonyl)-S-(methylsulfonyl)-L-cysteine, 95%, N-Boc-L-cysteine Methanethiosulfonate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonylsulfanylpropanoic acid (CAS 1043867-42-0) is a chemical compound with the molecular formula C9H17NO6S2 and a molecular weight of 299.4 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonylsulfanylpropanoic acid. InChIKey: LTHCCMQDIJSFSH-LURJTMIESA-N.
| Molecular formula | C9H17NO6S2 |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonylsulfanylpropanoic acid |
| InChIKey | LTHCCMQDIJSFSH-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)