Products 1044519-48-3
CAS 1044519-48-3 is the registry number for Phenylboronic acid-13C6. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1,2,3,4,5,6-13C6)cyclohexatrienylboronic acid (CAS 1044519-48-3) is a chemical compound with the molecular formula C6H7BO2 and a molecular weight of 127.89 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexatrienylboronic acid. InChIKey: HXITXNWTGFUOAU-IDEBNGHGSA-N.
| Molecular formula | C6H7BO2 |
|---|---|
| Molecular weight | 127.89 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexatrienylboronic acid |
| InChIKey | HXITXNWTGFUOAU-IDEBNGHGSA-N |
| SMILES | B([13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1)(O)O |
Computed by PubChem (NCBI)
Synonyms:
Phenylboronic Acid-13C6, (Phenyl-13C6)boronic acid