Products 1044566-28-0
CAS 1044566-28-0 is the registry number for Galectin-4-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,4S,5S,6R)-5-acetyloxy-3-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] 4-methylbenzoate (CAS 1044566-28-0) is a chemical compound with the molecular formula C17H22O8 and a molecular weight of 354.4 g/mol. IUPAC name: [(2R,3S,4S,5S,6R)-5-acetyloxy-3-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] 4-methylbenzoate. InChIKey: IYJMKTZAMJWCQH-JLHDYFKBSA-N.
| Molecular formula | C17H22O8 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | [(2R,3S,4S,5S,6R)-5-acetyloxy-3-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] 4-methylbenzoate |
| InChIKey | IYJMKTZAMJWCQH-JLHDYFKBSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)O[C@H]2[C@H]([C@H](O[C@H]([C@H]2OC(=O)C)OC)CO)O |
Computed by PubChem (NCBI)