CAS 1044731-69-2 is the registry number for N-[(5-Cyano-2-furyl)methyl]-n,n-diethylethanaminium bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(5-cyanofuran-2-yl)methyl-triethylazanium bromide (CAS 1044731-69-2) is a chemical compound with the molecular formula C12H19BrN2O and a molecular weight of 287.20 g/mol. IUPAC name: (5-cyanofuran-2-yl)methyl-triethylazanium bromide. InChIKey: WAPVHSCOUGLAHQ-UHFFFAOYSA-M.
| Molecular formula | C12H19BrN2O |
|---|---|
| Molecular weight | 287.20 g/mol |
| IUPAC name | (5-cyanofuran-2-yl)methyl-triethylazanium bromide |
| InChIKey | WAPVHSCOUGLAHQ-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC1=CC=C(O1)C#N.[Br-] |
Computed by PubChem (NCBI)