CAS 1044768-45-7 is the registry number for 4–Chloro–6–fluoro–2–methylpyrido(3,4–d)pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg.
4-chloro-6-fluoro-2-methylpyrido[3,4-d]pyrimidine (CAS 1044768-45-7) is a chemical compound with the molecular formula C8H5ClFN3 and a molecular weight of 197.60 g/mol. IUPAC name: 4-chloro-6-fluoro-2-methylpyrido[3,4-d]pyrimidine. InChIKey: SXLNWUHSIPYGHJ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFN3 |
|---|---|
| Molecular weight | 197.60 g/mol |
| IUPAC name | 4-chloro-6-fluoro-2-methylpyrido[3,4-d]pyrimidine |
| InChIKey | SXLNWUHSIPYGHJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CN=C(C=C2C(=N1)Cl)F |
Computed by PubChem (NCBI)