CAS 10448-09-6 is the registry number for Heptamethylphenylcyclotetrasiloxane. Offered by: TRC. Available pack sizes: 100mg.
2,2,4,4,6,6,8-heptamethyl-8-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (CAS 10448-09-6) is a chemical compound with the molecular formula C13H26O4Si4 and a molecular weight of 358.68 g/mol. IUPAC name: 2,2,4,4,6,6,8-heptamethyl-8-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane. InChIKey: NSLNFHKUIKHPGY-UHFFFAOYSA-N.
| Molecular formula | C13H26O4Si4 |
|---|---|
| Molecular weight | 358.68 g/mol |
| IUPAC name | 2,2,4,4,6,6,8-heptamethyl-8-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| InChIKey | NSLNFHKUIKHPGY-UHFFFAOYSA-N |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O1)(C)C)(C)C2=CC=CC=C2)(C)C)C |
Computed by PubChem (NCBI)