Products 10448-84-7
CAS 10448-84-7 appears in our catalog under these names: Nitromifene, Nitromifene (CI628), 1-(2-(4-(1-(4-Methoxyphenyl)-2-nitro-2-phenylethenyl)phenoxy)ethyl)pyrrolidine. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 10mg, 5mg, 50mg, Get quote.
1-[2-[4-[1-(4-methoxyphenyl)-2-nitro-2-phenylethenyl]phenoxy]ethyl]pyrrolidine (CAS 10448-84-7) is a chemical compound with the molecular formula C27H28N2O4 and a molecular weight of 444.5 g/mol. IUPAC name: 1-[2-[4-[1-(4-methoxyphenyl)-2-nitro-2-phenylethenyl]phenoxy]ethyl]pyrrolidine. InChIKey: MFKMXUFMHOCZHP-UHFFFAOYSA-N.
| Molecular formula | C27H28N2O4 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | 1-[2-[4-[1-(4-methoxyphenyl)-2-nitro-2-phenylethenyl]phenoxy]ethyl]pyrrolidine |
| InChIKey | MFKMXUFMHOCZHP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=C(C2=CC=CC=C2)[N+](=O)[O-])C3=CC=C(C=C3)OCCN4CCCC4 |
Computed by PubChem (NCBI)