CAS 104483-05-8 appears in our catalog under these names: 2,2-Dibromo-1-(4-isobutylphenyl)propan-1-one, 98%, 4'-Isobutyl-2,2-dibromopropiophenone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg.
2,2-dibromo-1-[4-(2-methylpropyl)phenyl]propan-1-one (CAS 104483-05-8) is a chemical compound with the molecular formula C13H16Br2O and a molecular weight of 348.07 g/mol. IUPAC name: 2,2-dibromo-1-[4-(2-methylpropyl)phenyl]propan-1-one. InChIKey: VJJIRVKFCUIHNX-UHFFFAOYSA-N.
| Molecular formula | C13H16Br2O |
|---|---|
| Molecular weight | 348.07 g/mol |
| IUPAC name | 2,2-dibromo-1-[4-(2-methylpropyl)phenyl]propan-1-one |
| InChIKey | VJJIRVKFCUIHNX-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(=O)C(C)(Br)Br |
Computed by PubChem (NCBI)