CAS 104483-68-3 is the registry number for 3,3-Dimethyl-1-(2-(trifluoromethyl)phenyl)butan-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,3-dimethyl-1-[2-(trifluoromethyl)phenyl]butan-2-one (CAS 104483-68-3) is a chemical compound with the molecular formula C13H15F3O and a molecular weight of 244.25 g/mol. IUPAC name: 3,3-dimethyl-1-[2-(trifluoromethyl)phenyl]butan-2-one. InChIKey: YJUGHFICDPXBOW-UHFFFAOYSA-N.
| Molecular formula | C13H15F3O |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 3,3-dimethyl-1-[2-(trifluoromethyl)phenyl]butan-2-one |
| InChIKey | YJUGHFICDPXBOW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC1=CC=CC=C1C(F)(F)F |
Computed by PubChem (NCBI)