Products 104497-77-0

CAS 104497-77-0 appears in our catalog under these names: 2,3–Di(p–tolyl)–5–phenyltetrazolium Chloride, 2,3-Di(p-tolyl)-5-phenyltetrazolium Chloride, 5-Phenyl-2,3-di-p-tolyl-2H-tetrazol-3-ium chloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 50mg, 10mg.

Structural formula: {0} (CAS {1})

2,3-bis(4-methylphenyl)-5-phenyltetrazol-2-ium chloride (CAS 104497-77-0) is a chemical compound with the molecular formula C21H19ClN4 and a molecular weight of 362.9 g/mol. IUPAC name: 2,3-bis(4-methylphenyl)-5-phenyltetrazol-2-ium chloride. InChIKey: OUFYUKONKRMAMS-UHFFFAOYSA-M.

Identity
Molecular formulaC21H19ClN4
Molecular weight362.9 g/mol
IUPAC name2,3-bis(4-methylphenyl)-5-phenyltetrazol-2-ium chloride
InChIKeyOUFYUKONKRMAMS-UHFFFAOYSA-M
SMILESCC1=CC=C(C=C1)N2N=C(N=[N+]2C3=CC=C(C=C3)C)C4=CC=CC=C4.[Cl-]

Computed by PubChem (NCBI)