CAS 104499-99-2 appears in our catalog under these names: 5,5''-Diiodo-2,2':5',2''-terthiophene, 97%, 97%, 5,5′′-Diiodo-2,2′:5′,2′′-terthiophene, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,5-bis(5-iodothiophen-2-yl)thiophene (CAS 104499-99-2) is a chemical compound with the molecular formula C12H6I2S3 and a molecular weight of 500.2 g/mol. IUPAC name: 2,5-bis(5-iodothiophen-2-yl)thiophene. InChIKey: UBTCAGOSLSIKMP-UHFFFAOYSA-N.
| Molecular formula | C12H6I2S3 |
|---|---|
| Molecular weight | 500.2 g/mol |
| IUPAC name | 2,5-bis(5-iodothiophen-2-yl)thiophene |
| InChIKey | UBTCAGOSLSIKMP-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)C2=CC=C(S2)I)C3=CC=C(S3)I |
Computed by PubChem (NCBI)