CAS 10452-78-5 is the registry number for 2,6-Di-tert-butyl-4-nitrophenol, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g, 10g.
2,6-ditert-butyl-4-nitrophenol (CAS 10452-78-5) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: 2,6-ditert-butyl-4-nitrophenol. InChIKey: FCGKUUOTWLWJHE-UHFFFAOYSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-nitrophenol |
| InChIKey | FCGKUUOTWLWJHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)