CAS 1045802-35-4 is the registry number for 1,3-Dimethyl-N-(3',4',5'-trifluoro(1,1'-biphenyl)-2-yl)-1H-pyrazole-4-carboxamide. Offered by: TRC. Available pack sizes: 500mg.
1,3-dimethyl-N-[2-(3,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide (CAS 1045802-35-4) is a chemical compound with the molecular formula C18H14F3N3O and a molecular weight of 345.3 g/mol. IUPAC name: 1,3-dimethyl-N-[2-(3,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide. InChIKey: UJLRDONJQRUUHU-UHFFFAOYSA-N.
| Molecular formula | C18H14F3N3O |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | 1,3-dimethyl-N-[2-(3,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide |
| InChIKey | UJLRDONJQRUUHU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1C(=O)NC2=CC=CC=C2C3=CC(=C(C(=C3)F)F)F)C |
Computed by PubChem (NCBI)