CAS 1046118-44-8 appears in our catalog under these names: Dihydroxy Diketo Atorvastatin Impurity, Atorvastatin Impurity 117. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[2-(4-fluorophenyl)-1-hydroxy-2-oxo-1-phenylethyl]-2-hydroxy-4-methyl-3-oxo-N-phenylpentanamide (CAS 1046118-44-8) is a chemical compound with the molecular formula C26H24FNO5 and a molecular weight of 449.5 g/mol. IUPAC name: 2-[2-(4-fluorophenyl)-1-hydroxy-2-oxo-1-phenylethyl]-2-hydroxy-4-methyl-3-oxo-N-phenylpentanamide. InChIKey: KNFWPOXFDYWKMV-UHFFFAOYSA-N.
| Molecular formula | C26H24FNO5 |
|---|---|
| Molecular weight | 449.5 g/mol |
| IUPAC name | 2-[2-(4-fluorophenyl)-1-hydroxy-2-oxo-1-phenylethyl]-2-hydroxy-4-methyl-3-oxo-N-phenylpentanamide |
| InChIKey | KNFWPOXFDYWKMV-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C(C(=O)NC1=CC=CC=C1)(C(C2=CC=CC=C2)(C(=O)C3=CC=C(C=C3)F)O)O |
Computed by PubChem (NCBI)