CAS 1046269-91-3 is the registry number for 2-((2,3-Dimethylphenyl)amino)-N-(methylcarbamoyl)propanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,3-dimethylanilino)-N-(methylcarbamoyl)propanamide (CAS 1046269-91-3) is a chemical compound with the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. IUPAC name: 2-(2,3-dimethylanilino)-N-(methylcarbamoyl)propanamide. InChIKey: DCYYTIVICXEUEQ-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2 |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | 2-(2,3-dimethylanilino)-N-(methylcarbamoyl)propanamide |
| InChIKey | DCYYTIVICXEUEQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC(C)C(=O)NC(=O)NC)C |
Computed by PubChem (NCBI)