Products 104654-66-2

CAS 104654-66-2 is the registry number for Methyl 1-(hydroxymethyl)cyclohexane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 1-(hydroxymethyl)cyclohexane-1-carboxylate (CAS 104654-66-2) is a chemical compound with the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. IUPAC name: methyl 1-(hydroxymethyl)cyclohexane-1-carboxylate. InChIKey: MQCJOSOCKDEXMV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O3
Molecular weight172.22 g/mol
IUPAC namemethyl 1-(hydroxymethyl)cyclohexane-1-carboxylate
InChIKeyMQCJOSOCKDEXMV-UHFFFAOYSA-N
SMILESCOC(=O)C1(CCCCC1)CO

Computed by PubChem (NCBI)