CAS 1046786-08-6 appears in our catalog under these names: [(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium tetrafluoroborate, 95%, [(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate, >98.0%(HPLC)(N), [(Oxido)phenyl(trifluoromethyl)-lambda4-sulfanylidene]dimethylammonium Tetrafluoroborate, 98.0%, 98.0%. Offered by: Combi-blocks, TCI, Chemat. Available pack sizes: 1g, 250mg, 200mg.
CAS 1046786-08-6 identifies a chemical compound with the molecular formula C9H11BF7NOS and a molecular weight of 325.06 g/mol. InChIKey: JQIUQSKIGNTITL-UHFFFAOYSA-N.
| Molecular formula | C9H11BF7NOS |
|---|---|
| Molecular weight | 325.06 g/mol |
| InChIKey | JQIUQSKIGNTITL-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CN(C)[S+](=O)(C1=CC=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)