CAS 104690-48-4 is the registry number for 6-Iodo-(1,2,4)triazolo(1,5-a)pyrimidin-7-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-iodo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 104690-48-4) is a chemical compound with the molecular formula C5H3IN4O and a molecular weight of 262.01 g/mol. IUPAC name: 6-iodo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: IDOPZQKRRXDMKX-UHFFFAOYSA-N.
| Molecular formula | C5H3IN4O |
|---|---|
| Molecular weight | 262.01 g/mol |
| IUPAC name | 6-iodo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | IDOPZQKRRXDMKX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)N2C(=N1)N=CN2)I |
Computed by PubChem (NCBI)