CAS 104729-49-9 is the registry number for 1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulphonyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonyl fluoride (CAS 104729-49-9) is a chemical compound with the molecular formula C4HF9O3S and a molecular weight of 300.10 g/mol. IUPAC name: 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonyl fluoride. InChIKey: XLXYXEHVIIRCGY-UHFFFAOYSA-N.
| Molecular formula | C4HF9O3S |
|---|---|
| Molecular weight | 300.10 g/mol |
| IUPAC name | 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonyl fluoride |
| InChIKey | XLXYXEHVIIRCGY-UHFFFAOYSA-N |
| SMILES | C(C(OC(C(F)(F)S(=O)(=O)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)