CAS 104771-87-1 is the registry number for Phenylacetylglutamine (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium (2S)-5-amino-5-oxo-2-[(2-phenylacetyl)amino]pentanoate (CAS 104771-87-1) is a chemical compound with the molecular formula C13H15N2NaO4 and a molecular weight of 286.26 g/mol. IUPAC name: sodium (2S)-5-amino-5-oxo-2-[(2-phenylacetyl)amino]pentanoate. InChIKey: JABIYIZXMBIFLT-PPHPATTJSA-M.
| Molecular formula | C13H15N2NaO4 |
|---|---|
| Molecular weight | 286.26 g/mol |
| IUPAC name | sodium (2S)-5-amino-5-oxo-2-[(2-phenylacetyl)amino]pentanoate |
| InChIKey | JABIYIZXMBIFLT-PPHPATTJSA-M |
| SMILES | C1=CC=C(C=C1)CC(=O)N[C@@H](CCC(=O)N)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)