CAS 104779-70-6 is the registry number for 1,2,4,5-Tetrakis(dimethylamino)benzene. Offered by: TRC. Available pack sizes: 1g.
1-N,1-N,2-N,2-N,4-N,4-N,5-N,5-N-octamethylbenzene-1,2,4,5-tetramine (CAS 104779-70-6) is a chemical compound with the molecular formula C14H26N4 and a molecular weight of 250.38 g/mol. IUPAC name: 1-N,1-N,2-N,2-N,4-N,4-N,5-N,5-N-octamethylbenzene-1,2,4,5-tetramine. InChIKey: SZKUMTPMEJTJOH-UHFFFAOYSA-N.
| Molecular formula | C14H26N4 |
|---|---|
| Molecular weight | 250.38 g/mol |
| IUPAC name | 1-N,1-N,2-N,2-N,4-N,4-N,5-N,5-N-octamethylbenzene-1,2,4,5-tetramine |
| InChIKey | SZKUMTPMEJTJOH-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1N(C)C)N(C)C)N(C)C |
Computed by PubChem (NCBI)