Products 10479-62-6
CAS 10479-62-6 appears in our catalog under these names: trans-Octahydro-1h-isoindole hydrochloride, 95%, Perospirone Impurity 30 HCl, trans-Octahydro-1H-isoindole hydrochloride, 98+%, (3aR，7aR)–Octahydro–1H–isoindole hydrochloride. Offered by: Combi-blocks, Chemat Brand, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, on request, 100mg.
(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole;hydrochloride (CAS 10479-62-6) is a chemical compound with the molecular formula C8H16ClN and a molecular weight of 161.67 g/mol. IUPAC name: (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole;hydrochloride. InChIKey: CLQIZUYXKFTUEB-WSZWBAFRSA-N.
| Molecular formula | C8H16ClN |
|---|---|
| Molecular weight | 161.67 g/mol |
| IUPAC name | (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole;hydrochloride |
| InChIKey | CLQIZUYXKFTUEB-WSZWBAFRSA-N |
| SMILES | C1CC[C@H]2CNC[C@@H]2C1.Cl |
Computed by PubChem (NCBI)