Products 1047997-30-7
CAS 1047997-30-7 is the registry number for Difluorocyclooctyne-CH2-benzoic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(2,2-difluorocyclooct-3-yn-1-yl)methyl]benzoic acid (CAS 1047997-30-7) is a chemical compound with the molecular formula C16H16F2O2 and a molecular weight of 278.29 g/mol. IUPAC name: 4-[(2,2-difluorocyclooct-3-yn-1-yl)methyl]benzoic acid. InChIKey: QOCBRLNYKZCCPG-UHFFFAOYSA-N.
| Molecular formula | C16H16F2O2 |
|---|---|
| Molecular weight | 278.29 g/mol |
| IUPAC name | 4-[(2,2-difluorocyclooct-3-yn-1-yl)methyl]benzoic acid |
| InChIKey | QOCBRLNYKZCCPG-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C#CC1)(F)F)CC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)