CAS 1048-08-4 appears in our catalog under these names: Tetraphenylsilane, Tetraphenylsilane, >97.0%(GC), Tetraphenylsilane 98%, Tetraphenylsilane, 98%, 98%, Tetraphenylsilane, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100mg, 100g.
Tetraphenylsilane (CAS 1048-08-4) is a chemical compound with the molecular formula C24H20Si and a molecular weight of 336.5 g/mol. IUPAC name: tetraphenylsilane. InChIKey: JLAVCPKULITDHO-UHFFFAOYSA-N.
| Molecular formula | C24H20Si |
|---|---|
| Molecular weight | 336.5 g/mol |
| IUPAC name | tetraphenylsilane |
| InChIKey | JLAVCPKULITDHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)