CAS 104809-32-7 appears in our catalog under these names: β-Nicotinamide adenine dinucleotide reduced dipotassium, β–Nicotinamide adenine dinucleotide reduced dipotassium, β-Nicotinamide adenine dinucleotide reduced (dipotassium), 95%, 95%, β-Nicotinamide adenine dinucleotide reduced (dipotassium). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, Get quote.
CAS 104809-32-7 identifies a chemical compound with the molecular formula C21H29KN7O14P2 and a molecular weight of 704.5 g/mol. InChIKey: ZUPXXZAVUHFCNV-UHFFFAOYSA-N.
| Molecular formula | C21H29KN7O14P2 |
|---|---|
| Molecular weight | 704.5 g/mol |
| InChIKey | ZUPXXZAVUHFCNV-UHFFFAOYSA-N |
| SMILES | C1C=CN(C=C1C(=O)N)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OCC3C(C(C(O3)N4C=NC5=C(N=CN=C54)N)O)O)O)O.[K] |
Computed by PubChem (NCBI)