CAS 104821-25-2 appears in our catalog under these names: Dihydroethidium, Dihydroethidium/ 99.52% (existing batch purity), Dihydroethidium, 95.00%, Dihydroethidium 98%, DIHYDROETHIDIUM SUITABLE FOR FLUORESCEN&. Offered by: TRC, TargetMol, Chemat, Biosynth, Ambeed. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 200mg, 500mg, 1mg.
5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine (CAS 104821-25-2) is a chemical compound with the molecular formula C21H21N3 and a molecular weight of 315.4 g/mol. IUPAC name: 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine. InChIKey: XYJODUBPWNZLML-UHFFFAOYSA-N.
| Molecular formula | C21H21N3 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine |
| InChIKey | XYJODUBPWNZLML-UHFFFAOYSA-N |
| SMILES | CCN1C(C2=C(C=CC(=C2)N)C3=C1C=C(C=C3)N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)