Products 104832-21-5
CAS 104832-21-5 is the registry number for (3aS,6aS)-2,2,6-trimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(3aS,6aS)-2,2,6-trimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one (CAS 104832-21-5) is a chemical compound with the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. IUPAC name: (3aS,6aS)-2,2,6-trimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one. InChIKey: UXXHMMVNUXVRAX-JGVFFNPUSA-N.
| Molecular formula | C9H12O3 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | (3aS,6aS)-2,2,6-trimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one |
| InChIKey | UXXHMMVNUXVRAX-JGVFFNPUSA-N |
| SMILES | CC1=CC(=O)[C@@H]2[C@H]1OC(O2)(C)C |
Computed by PubChem (NCBI)