CAS 104833-43-4 is the registry number for 1-Amino-1-deoxy-D-glucitol hydrochloride. Offered by: Biosynth. Available pack sizes: 1g.
(2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;hydrochloride (CAS 104833-43-4) is a chemical compound with the molecular formula C6H16ClNO5 and a molecular weight of 217.65 g/mol. IUPAC name: (2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;hydrochloride. InChIKey: GTGZGTMCSYIRON-BTVCFUMJSA-N.
| Molecular formula | C6H16ClNO5 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | (2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;hydrochloride |
| InChIKey | GTGZGTMCSYIRON-BTVCFUMJSA-N |
| SMILES | C([C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)N.Cl |
Computed by PubChem (NCBI)