Products 1048340-09-5

CAS 1048340-09-5 is the registry number for 4-Chloro-1-methyl-1h-pyrazole-3-carbonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

4-chloro-1-methylpyrazole-3-carbonyl chloride (CAS 1048340-09-5) is a chemical compound with the molecular formula C5H4Cl2N2O and a molecular weight of 179.00 g/mol. IUPAC name: 4-chloro-1-methylpyrazole-3-carbonyl chloride. InChIKey: UGGVYWVYYZYMNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4Cl2N2O
Molecular weight179.00 g/mol
IUPAC name4-chloro-1-methylpyrazole-3-carbonyl chloride
InChIKeyUGGVYWVYYZYMNZ-UHFFFAOYSA-N
SMILESCN1C=C(C(=N1)C(=O)Cl)Cl

Computed by PubChem (NCBI)