CAS 1048343-53-8 is the registry number for 2-(7-Bromo-5-fluoro-2-methyl-1H-indol-3-yl)ethylamine oxalate. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
2-(7-bromo-5-fluoro-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid (CAS 1048343-53-8) is a chemical compound with the molecular formula C13H14BrFN2O4 and a molecular weight of 361.16 g/mol. IUPAC name: 2-(7-bromo-5-fluoro-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid. InChIKey: ILUFVQPQTOZVRG-UHFFFAOYSA-N.
| Molecular formula | C13H14BrFN2O4 |
|---|---|
| Molecular weight | 361.16 g/mol |
| IUPAC name | 2-(7-bromo-5-fluoro-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid |
| InChIKey | ILUFVQPQTOZVRG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C(=CC(=C2)F)Br)CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)