CAS 1048343-64-1 is the registry number for 2-[2-Methyl-7-(trifluoromethyl)-1h-indol-3-yl]ethanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
2-[2-methyl-7-(trifluoromethyl)-1H-indol-3-yl]ethanamine;hydrochloride (CAS 1048343-64-1) is a chemical compound with the molecular formula C12H14ClF3N2 and a molecular weight of 278.70 g/mol. IUPAC name: 2-[2-methyl-7-(trifluoromethyl)-1H-indol-3-yl]ethanamine;hydrochloride. InChIKey: XNDORQLPOLINRM-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF3N2 |
|---|---|
| Molecular weight | 278.70 g/mol |
| IUPAC name | 2-[2-methyl-7-(trifluoromethyl)-1H-indol-3-yl]ethanamine;hydrochloride |
| InChIKey | XNDORQLPOLINRM-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C(=CC=C2)C(F)(F)F)CCN.Cl |
Computed by PubChem (NCBI)