CAS 10485-47-9 is the registry number for 4-Ethoxy-N,N,N-trimethyl-2,4-dioxo-1-butanaminium. Offered by: TRC. Available pack sizes: 5g.
(4-ethoxy-2,4-dioxobutyl)-trimethylazanium (CAS 10485-47-9) is a chemical compound with the molecular formula C9H18NO3+ and a molecular weight of 188.24 g/mol. IUPAC name: (4-ethoxy-2,4-dioxobutyl)-trimethylazanium. InChIKey: ROLRXDIMKFRADI-UHFFFAOYSA-N.
| Molecular formula | C9H18NO3+ |
|---|---|
| Molecular weight | 188.24 g/mol |
| IUPAC name | (4-ethoxy-2,4-dioxobutyl)-trimethylazanium |
| InChIKey | ROLRXDIMKFRADI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C[N+](C)(C)C |
Computed by PubChem (NCBI)