Products 1048648-84-5
CAS 1048648-84-5 is the registry number for 2-Methyl-5-nitrobenzenesulfonic acid-[1-(1-adamantyl)ethyl]amine (1:1), 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.
1-(1-adamantyl)ethanamine;2-methyl-5-nitrobenzenesulfonic acid (CAS 1048648-84-5) is a chemical compound with the molecular formula C19H28N2O5S and a molecular weight of 396.5 g/mol. IUPAC name: 1-(1-adamantyl)ethanamine;2-methyl-5-nitrobenzenesulfonic acid. InChIKey: UODURDZHMDXVTC-UHFFFAOYSA-N.
| Molecular formula | C19H28N2O5S |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | 1-(1-adamantyl)ethanamine;2-methyl-5-nitrobenzenesulfonic acid |
| InChIKey | UODURDZHMDXVTC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)O.CC(C12CC3CC(C1)CC(C3)C2)N |
Computed by PubChem (NCBI)