CAS 10488-04-7 is the registry number for rac-[(1R,2R)-2-phenylcyclopropyl]methanol. Offered by: Chemat. Available pack sizes: 250mg, 1g.
[(1R,2R)-2-phenylcyclopropyl]methanol (CAS 10488-04-7) is a chemical compound with the molecular formula C10H12O and a molecular weight of 148.20 g/mol. IUPAC name: [(1R,2R)-2-phenylcyclopropyl]methanol. InChIKey: CEZOORGGKZLLAO-UWVGGRQHSA-N.
| Molecular formula | C10H12O |
|---|---|
| Molecular weight | 148.20 g/mol |
| IUPAC name | [(1R,2R)-2-phenylcyclopropyl]methanol |
| InChIKey | CEZOORGGKZLLAO-UWVGGRQHSA-N |
| SMILES | C1[C@H]([C@@H]1C2=CC=CC=C2)CO |
Computed by PubChem (NCBI)