CAS 1048953-96-3 is the registry number for Lasofoxifene Sulfate. Offered by: Chemat Brand. Available pack sizes: on request.
[(5R,6S)-6-phenyl-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl] hydrogen sulfate (CAS 1048953-96-3) is a chemical compound with the molecular formula C28H31NO5S and a molecular weight of 493.6 g/mol. IUPAC name: [(5R,6S)-6-phenyl-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl] hydrogen sulfate. InChIKey: NXQINUGCNDMKEW-IAPPQJPRSA-N.
| Molecular formula | C28H31NO5S |
|---|---|
| Molecular weight | 493.6 g/mol |
| IUPAC name | [(5R,6S)-6-phenyl-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl] hydrogen sulfate |
| InChIKey | NXQINUGCNDMKEW-IAPPQJPRSA-N |
| SMILES | C1CCN(C1)CCOC2=CC=C(C=C2)[C@H]3[C@H](CCC4=C3C=CC(=C4)OS(=O)(=O)O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)